CAS 137157-50-7 appears in our catalog under these names: Benzyl ((2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)carbamate, 98%, N-Carbobenzyloxy Mannosamine, 2-Amino-2-N-carbobenzoxy-2-deoxy-D-mannose. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 1g, 50mg, 250mg, 500mg, 100 mg, 1 g.
Benzyl N-[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate (CAS 137157-50-7) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: benzyl N-[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate. InChIKey: FRTOTMQAWIIMKK-JBSNKVJHSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | benzyl N-[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
| InChIKey | FRTOTMQAWIIMKK-JBSNKVJHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2[C@H]([C@@H](C(OC2O)CO)O)O |
Computed by PubChem (NCBI)