CAS 1174233-24-9 appears in our catalog under these names: 2-(Benzyloxycarbonylamino)-2-deoxy-D-mannose, 98%, 2-(Benzyloxycarbonylamino)-2-deoxy-D-mannose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 100mg.
Benzyl N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamate (CAS 1174233-24-9) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: benzyl N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamate. InChIKey: GLXPSFVNAPWXDF-FDYHWXHSSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | benzyl N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamate |
| InChIKey | GLXPSFVNAPWXDF-FDYHWXHSSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)