cas: 774549-55-2 — see every product listed under this CAS number, including other names
Pyrazolo[1,5-a]pyrimidine-3-carboxamide, 95%, 95% (CAS 774549-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116LFH-100mg |
| cas | 774549-55-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 707.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Pyrazolo[1,5-a]pyrimidine-3-carboxamide (CAS 774549-55-2) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: pyrazolo[1,5-a]pyrimidine-3-carboxamide. InChIKey: XMRIUEGHBZTNND-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| InChIKey | XMRIUEGHBZTNND-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)N)N=C1 |
Computed by PubChem (NCBI)