cas: 57266-70-3 — see every product listed under this CAS number, including other names
Pyridazine-3,6-dicarboxylic acid, 97% (CAS 57266-70-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237065-250MG |
| cas | 57266-70-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1315.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Pyridazine-3,6-dicarboxylic acid (CAS 57266-70-3) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyridazine-3,6-dicarboxylic acid. InChIKey: FJPJFQGISLJONZ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyridazine-3,6-dicarboxylic acid |
| InChIKey | FJPJFQGISLJONZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)