cas: 127527-24-6 — see every product listed under this CAS number, including other names
Pyrimidine-2,5-dicarboxylic acid, 95%, 95% (CAS 127527-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111X6H-100mg |
| cas | 127527-24-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1946.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Pyrimidine-2,5-dicarboxylic acid (CAS 127527-24-6) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrimidine-2,5-dicarboxylic acid. InChIKey: PIVRLVQKXVLRCA-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrimidine-2,5-dicarboxylic acid |
| InChIKey | PIVRLVQKXVLRCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)