Pyrimidine-4,6-dicarboxylic acid, 95%
cas: 16490-02-1 — see every product listed under this CAS number, including other names
Pyrimidine-4,6-dicarboxylic acid, 95% (CAS 16490-02-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A133911-1g |
| cas | 16490-02-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 270.25 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1349.38 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 281.04 Pln | |
| BLDpharm | 25g | 497.63 Pln | |
| BLDpharm | 100g | 1452.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Pyrimidine-4,6-dicarboxylic acid (CAS 16490-02-1) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrimidine-4,6-dicarboxylic acid. InChIKey: XIEOKRXVAACBHI-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrimidine-4,6-dicarboxylic acid |
| InChIKey | XIEOKRXVAACBHI-UHFFFAOYSA-N |
| SMILES | C1=C(N=CN=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)