cas: 629644-82-2 — see every product listed under this CAS number, including other names
Quinolin-7-ylboronic acid, 97%, 97% (CAS 629644-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147ZK-100mg |
| cas | 629644-82-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1197.20 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 4130.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Quinolin-7-ylboronic acid (CAS 629644-82-2) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-7-ylboronic acid. InChIKey: ZMEMBOIUHLWVRX-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-7-ylboronic acid |
| InChIKey | ZMEMBOIUHLWVRX-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=CC=N2)C=C1)(O)O |
Computed by PubChem (NCBI)