CAS 192182-56-2 appears in our catalog under these names: Isoquinoline-4-boronic acid, 96%, 4-Isoquinolineboronic acid 98%, Isoquinoline-4-boronic acid, 98%, 98%, Isoquinoline-4-boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 100mg, 250mg.
Isoquinolin-4-ylboronic acid (CAS 192182-56-2) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-4-ylboronic acid. InChIKey: GDTOUTKTCGPAGY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-4-ylboronic acid |
| InChIKey | GDTOUTKTCGPAGY-UHFFFAOYSA-N |
| SMILES | B(C1=CN=CC2=CC=CC=C12)(O)O |
Computed by PubChem (NCBI)