CAS 850568-63-7 is the registry number for 2-(E-Cyanovinyl)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-[(E)-2-cyanoethenyl]phenyl]boronic acid (CAS 850568-63-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: [2-[(E)-2-cyanoethenyl]phenyl]boronic acid. InChIKey: IBOPZLYQFBLSRH-HWKANZROSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | [2-[(E)-2-cyanoethenyl]phenyl]boronic acid |
| InChIKey | IBOPZLYQFBLSRH-HWKANZROSA-N |
| SMILES | B(C1=CC=CC=C1/C=C/C#N)(O)O |
Computed by PubChem (NCBI)