CAS 850568-53-5 appears in our catalog under these names: 3-(E-2-Cyanovinyl)phenylboronic acid, 97%, 3-(E-2-Cyanovinyl)Phenylboronic Acid, ≥97%, ≥97%, (E)-(3-(2-Cyanovinyl)phenyl)boronic acid, ≥97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[3-[(E)-2-cyanoethenyl]phenyl]boronic acid (CAS 850568-53-5) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: [3-[(E)-2-cyanoethenyl]phenyl]boronic acid. InChIKey: YDSLGHLJEJPWNC-DUXPYHPUSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | [3-[(E)-2-cyanoethenyl]phenyl]boronic acid |
| InChIKey | YDSLGHLJEJPWNC-DUXPYHPUSA-N |
| SMILES | B(C1=CC(=CC=C1)/C=C/C#N)(O)O |
Computed by PubChem (NCBI)