cas: 171364-85-5 — see every product listed under this CAS number, including other names
Quinoline-3-boronic acid pinacol ester, 95% (CAS 171364-85-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218998-250MG |
| cas | 171364-85-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 81.24 Pln | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 502.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 171364-85-5) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: ARRJAONCYUAPJR-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | ARRJAONCYUAPJR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)