CAS 64302-87-0 appears in our catalog under these names: R162/ 96.21% (existing batch purity), R162, R162 98%, 2-Allyl-1-hydroxy-9,10-anthraquinone, 98%, 98%, R162, 99.98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
1-hydroxy-2-prop-2-enylanthracene-9,10-dione (CAS 64302-87-0) is a chemical compound with the molecular formula C17H12O3 and a molecular weight of 264.27 g/mol. IUPAC name: 1-hydroxy-2-prop-2-enylanthracene-9,10-dione. InChIKey: IMUBGIOLZQTIGI-UHFFFAOYSA-N.
| Molecular formula | C17H12O3 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | 1-hydroxy-2-prop-2-enylanthracene-9,10-dione |
| InChIKey | IMUBGIOLZQTIGI-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)