Products 48208-26-0
CAS 48208-26-0 appears in our catalog under these names: RG108/ 99.78% (existing batch purity), RG 108, DNA Methyltransferase Inhibito , RG 108, N-Phthalyl-L-tryptophan, >98.0%(HPLC)(T). Offered by: TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 10mM (in 1ml dmso).
2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid (CAS 48208-26-0) is a chemical compound with the molecular formula C19H14N2O4 and a molecular weight of 334.3 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid. InChIKey: HPTXLHAHLXOAKV-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | HPTXLHAHLXOAKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C(CC3=CNC4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid, DNA Methyltransferase Inhibitor, (Rac)-RG108, 2-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-3-(1H-indol-3-yl)-propionic acid, 2-(1,3-dioxoisoindolin-2-yl)-3-(1H-indol-3-yl)propanoic acid, 2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid, 2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid, s2821, Oprea1_410805, Oprea1_475901