CAS 17659-49-3 appears in our catalog under these names: Racanisodamine, Racanisodamine/ 99.76% (existing batch purity), Racanisodamine 97%, Racanisodamine, 97%, 97%, Racanisodamine, 98.75%. Offered by: Dr. Ehrenstorfer, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 50g, 25g, 250mg, 1g, 5g, 10g.
(6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate (CAS 17659-49-3) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate. InChIKey: WTQYWNWRJNXDEG-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate |
| InChIKey | WTQYWNWRJNXDEG-UHFFFAOYSA-N |
| SMILES | CN1C2CC(CC1C(C2)O)OC(=O)C(CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)