cas: 2245360-34-1 — see every product listed under this CAS number, including other names
Rel-(4aR,7aS)-4-methyloctahydropyrrolo[3,4-b][1,4]oxazine dihydrochloride, 98% (CAS 2245360-34-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch131654-50mg |
| cas | 2245360-34-1 |
| size | 50mg |
| availability | 8g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 582.80 Pln | |
| Chemat | 100mg | 904.40 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 4077.20 Pln | |
| Fluorochem | 50mg | 773.70 Pln | |
| Fluorochem | 100mg | 1216.26 Pln | |
| Fluorochem | 250mg | 1919.13 Pln | |
| Fluorochem | 1g | 5167.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4aR,7aS)-4-methyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride (CAS 2245360-34-1) is a chemical compound with the molecular formula C7H16Cl2N2O and a molecular weight of 215.12 g/mol. IUPAC name: (4aR,7aS)-4-methyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride. InChIKey: DASPSLWJQSFRBW-VJBFUYBPSA-N.
| Molecular formula | C7H16Cl2N2O |
|---|---|
| Molecular weight | 215.12 g/mol |
| IUPAC name | (4aR,7aS)-4-methyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;dihydrochloride |
| InChIKey | DASPSLWJQSFRBW-VJBFUYBPSA-N |
| SMILES | CN1CCO[C@@H]2[C@H]1CNC2.Cl.Cl |
Computed by PubChem (NCBI)