CAS 20788-07-2 appears in our catalog under these names: Resorantel, Resorantel/ 99.53% (existing batch purity), Resorantel 97%, Resorantel, 99%+(LC-MS),RG, 99%+(LC-MS),RG, Resorantel, 99.80%. Offered by: Mikromol, LoGiCal, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: 250mg, 10mg, 100mg, 25mg, 50mg, 200mg, 500mg, 1g.
N-(4-bromophenyl)-2,6-dihydroxybenzamide (CAS 20788-07-2) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: N-(4-bromophenyl)-2,6-dihydroxybenzamide. InChIKey: IHYNKGRWCDKNEG-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | N-(4-bromophenyl)-2,6-dihydroxybenzamide |
| InChIKey | IHYNKGRWCDKNEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C(=O)NC2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)