CAS 104153-37-9 appears in our catalog under these names: Rilopirox, Rilopirox/ 99.72% (existing batch purity). Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 1 mg.
6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one (CAS 104153-37-9) is a chemical compound with the molecular formula C19H16ClNO4 and a molecular weight of 357.8 g/mol. IUPAC name: 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one. InChIKey: UDYUIWXQUBNDHC-UHFFFAOYSA-N.
| Molecular formula | C19H16ClNO4 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one |
| InChIKey | UDYUIWXQUBNDHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C(=C1)COC2=CC=C(C=C2)OC3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)