cas: 162401-62-9 — see every product listed under this CAS number, including other names
RoflumilastRelated Compound D 98% (CAS 162401-62-9) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208015-500g |
| cas | 162401-62-9 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 8703.00 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 631.81 Pln | |
| Ambeed | 100g | 2228.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208015 |
3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid (CAS 162401-62-9) is a chemical compound with the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. IUPAC name: 3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid. InChIKey: IGFDIFLMMLWKKY-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O4 |
|---|---|
| Molecular weight | 258.22 g/mol |
| IUPAC name | 3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid |
| InChIKey | IGFDIFLMMLWKKY-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=CC(=C2)C(=O)O)OC(F)F |
Computed by PubChem (NCBI)