Products 2417310-77-9
CAS 2417310-77-9 is the registry number for 4-(tert-Butoxycarbonyl)-2,6-difluorobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid (CAS 2417310-77-9) is a chemical compound with the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. IUPAC name: 2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid. InChIKey: NHYIZIFZSUUJNL-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O4 |
|---|---|
| Molecular weight | 258.22 g/mol |
| IUPAC name | 2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid |
| InChIKey | NHYIZIFZSUUJNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C(=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)