CAS 2229219-47-8 appears in our catalog under these names: 1–(2,6–dimethoxyphenyl)–2,2–difluorocyclopropane–1–carboxylic acid, 1-(2,6-dimethoxyphenyl)-2,2-difluorocyclopropane-1-carboxylic acid, 1-(2,6-dimethoxyphenyl)-2,2-difluorocyclopropane-1-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 5g, 100mg.
1-(2,6-dimethoxyphenyl)-2,2-difluorocyclopropane-1-carboxylic acid (CAS 2229219-47-8) is a chemical compound with the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. IUPAC name: 1-(2,6-dimethoxyphenyl)-2,2-difluorocyclopropane-1-carboxylic acid. InChIKey: HAVBZGPSYCRLLH-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O4 |
|---|---|
| Molecular weight | 258.22 g/mol |
| IUPAC name | 1-(2,6-dimethoxyphenyl)-2,2-difluorocyclopropane-1-carboxylic acid |
| InChIKey | HAVBZGPSYCRLLH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C2(CC2(F)F)C(=O)O |
Computed by PubChem (NCBI)