Products 2376345-94-5

CAS 2376345-94-5 is the registry number for Roflumilast Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-cyclobutyloxy-4-(difluoromethoxy)benzoic acid (CAS 2376345-94-5) is a chemical compound with the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. IUPAC name: 3-cyclobutyloxy-4-(difluoromethoxy)benzoic acid. InChIKey: QMCKSTSOQYLEPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F2O4
Molecular weight258.22 g/mol
IUPAC name3-cyclobutyloxy-4-(difluoromethoxy)benzoic acid
InChIKeyQMCKSTSOQYLEPJ-UHFFFAOYSA-N
SMILESC1CC(C1)OC2=C(C=CC(=C2)C(=O)O)OC(F)F

Computed by PubChem (NCBI)