cas: 51096-49-2 — see every product listed under this CAS number, including other names
S-(-)-2-BenzylaMino-1-phenylethanol, 95%, 95% (CAS 51096-49-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AYZ-1g |
| cas | 51096-49-2 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Chemat | 100g | 1288.40 Pln | |
| Chemat | 50g | 683.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1S)-2-(benzylamino)-1-phenylethanol (CAS 51096-49-2) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (1S)-2-(benzylamino)-1-phenylethanol. InChIKey: XAOCLQUZOIZSHV-OAHLLOKOSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (1S)-2-(benzylamino)-1-phenylethanol |
| InChIKey | XAOCLQUZOIZSHV-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)CNC[C@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)