cas: 55288-30-7 — see every product listed under this CAS number, including other names
S-(4-Nitrophenyl)-L-cysteine, 98%, 98% (CAS 55288-30-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFEW-10mg |
| cas | 55288-30-7 |
| size | 10mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 131.60 Pln | |
| Chemat | 100mg | 587.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-(4-nitrophenyl)sulfanylpropanoic acid (CAS 55288-30-7) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: (2R)-2-amino-3-(4-nitrophenyl)sulfanylpropanoic acid. InChIKey: WXMIOWSCOYJQOT-QMMMGPOBSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-nitrophenyl)sulfanylpropanoic acid |
| InChIKey | WXMIOWSCOYJQOT-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)