CAS 143584-75-2 appears in our catalog under these names: S–methyl–KE–298 (M–2), S-methyl-KE-298/ 96.9% (existing batch purity), S-Methyl-ke-298, S-methyl-KE-298, ≥95%, ≥95%, S-methyl-KE-298, 98.0%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 200mg, 50 mg.
4-(4-methylphenyl)-2-(methylsulfanylmethyl)-4-oxobutanoic acid (CAS 143584-75-2) is a chemical compound with the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. IUPAC name: 4-(4-methylphenyl)-2-(methylsulfanylmethyl)-4-oxobutanoic acid. InChIKey: WRIZBWMOURRWRW-UHFFFAOYSA-N.
| Molecular formula | C13H16O3S |
|---|---|
| Molecular weight | 252.33 g/mol |
| IUPAC name | 4-(4-methylphenyl)-2-(methylsulfanylmethyl)-4-oxobutanoic acid |
| InChIKey | WRIZBWMOURRWRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(CSC)C(=O)O |
Computed by PubChem (NCBI)