CAS 56961-10-5 appears in our catalog under these names: SARS–CoV–2–IN–13, SARS-CoV-2-IN-13/ 98.15% (existing batch purity), SARS-CoV-2-IN-13, SARS-CoV-2-IN-13, 99.64%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, 100mg, 200mg, 10mM * 1mlindmso.
5-chloro-N-(3-chloro-4-nitrophenyl)-2-hydroxybenzamide (CAS 56961-10-5) is a chemical compound with the molecular formula C13H8Cl2N2O4 and a molecular weight of 327.12 g/mol. IUPAC name: 5-chloro-N-(3-chloro-4-nitrophenyl)-2-hydroxybenzamide. InChIKey: FKLGWJUBUPDJJI-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O4 |
|---|---|
| Molecular weight | 327.12 g/mol |
| IUPAC name | 5-chloro-N-(3-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| InChIKey | FKLGWJUBUPDJJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)