CAS 423169-68-0 appears in our catalog under these names: SC-57461A, SC-57461A/ 99.14% (existing batch purity), SC 57461A, SC-57461A, 99.91% ,, 99.91% ,, SC-57461A, 99.93%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 50mg, 5mg, 1mg, 10mg, 25mg, 100mg, 200mg.
3-[3-(4-benzylphenoxy)propyl-methylamino]propanoic acid;hydrochloride (CAS 423169-68-0) is a chemical compound with the molecular formula C20H26ClNO3 and a molecular weight of 363.9 g/mol. IUPAC name: 3-[3-(4-benzylphenoxy)propyl-methylamino]propanoic acid;hydrochloride. InChIKey: SBBJJLDNKNNWFJ-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO3 |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | 3-[3-(4-benzylphenoxy)propyl-methylamino]propanoic acid;hydrochloride |
| InChIKey | SBBJJLDNKNNWFJ-UHFFFAOYSA-N |
| SMILES | CN(CCCOC1=CC=C(C=C1)CC2=CC=CC=C2)CCC(=O)O.Cl |
Computed by PubChem (NCBI)