CAS 1241494-17-6 appears in our catalog under these names: SCD1/5–IN–1, SCD1/5-IN-1, 99.58%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50 mg, 10 mg, 5 mg, 10mM/1mL, 25 mg.
5-(furan-2-yl)-N-(1-methylpyrazol-4-yl)-1,2-oxazole-3-carboxamide (CAS 1241494-17-6) is a chemical compound with the molecular formula C12H10N4O3 and a molecular weight of 258.23 g/mol. IUPAC name: 5-(furan-2-yl)-N-(1-methylpyrazol-4-yl)-1,2-oxazole-3-carboxamide. InChIKey: FCICSKVGJNZDGZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O3 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 5-(furan-2-yl)-N-(1-methylpyrazol-4-yl)-1,2-oxazole-3-carboxamide |
| InChIKey | FCICSKVGJNZDGZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)NC(=O)C2=NOC(=C2)C3=CC=CO3 |
Computed by PubChem (NCBI)