cas: 345630-40-2 — see every product listed under this CAS number, including other names
SF1670, 98.57% (CAS 345630-40-2) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 200 mg, 100 mg, 10 mg, 10mM/1mL, 500 mg, 5 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-15842-50 mg |
| cas | 345630-40-2 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 3171.11 Pln | |
| MedChemExpress | 200 mg | 7267.12 Pln | |
| MedChemExpress | 100 mg | 4894.03 Pln | |
| MedChemExpress | 10 mg | 867.68 Pln | |
| MedChemExpress | 10mM/1mL | 751.58 Pln | |
| MedChemExpress | 500 mg | 11632.48 Pln | |
| MedChemExpress | 5 mg | 695.86 Pln | |
| MedChemExpress | 25 mg | 1791.84 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.57% |
N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide (CAS 345630-40-2) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide. InChIKey: VZQDDSYKVYARDW-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide |
| InChIKey | VZQDDSYKVYARDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC2=C(C=C1)C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)