cas: 345630-40-2 — see every product listed under this CAS number, including other names
SF1670, 99% (HPLC), 99% (HPLC) (CAS 345630-40-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CA1T-1mg |
| cas | 345630-40-2 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 208.40 Pln | |
| Chemat | 5mg | 434.00 Pln | |
| Chemat | 10mg | 659.60 Pln | |
| Chemat | 25mg | 856.40 Pln |
| purity | 99% (HPLC) |
|---|---|
| delivery time | 3 weeks |
N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide (CAS 345630-40-2) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide. InChIKey: VZQDDSYKVYARDW-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide |
| InChIKey | VZQDDSYKVYARDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC2=C(C=C1)C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)