CAS 2226517-76-4 appears in our catalog under these names: SGC-GAK-1/ 99.74% (existing batch purity), SGC GAK 1, SGC-GAK-1 98%, SGC GAK 1, 98%, 98%, SGC-GAK-1, 99.92%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5 mg.
6-bromo-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine (CAS 2226517-76-4) is a chemical compound with the molecular formula C18H17BrN2O3 and a molecular weight of 389.2 g/mol. IUPAC name: 6-bromo-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine. InChIKey: AUOSKLDNVNGKRR-UHFFFAOYSA-N.
| Molecular formula | C18H17BrN2O3 |
|---|---|
| Molecular weight | 389.2 g/mol |
| IUPAC name | 6-bromo-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine |
| InChIKey | AUOSKLDNVNGKRR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)NC2=C3C=C(C=CC3=NC=C2)Br |
Computed by PubChem (NCBI)