CAS 909089-13-0 appears in our catalog under these names: SKL2001/ 97.9% (existing batch purity), SKL2001, SKL 2001, SKL2001 98%, Wnt Agonist II, SKL2001 1PC X 25MG. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 10g.
5-(furan-2-yl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide (CAS 909089-13-0) is a chemical compound with the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. IUPAC name: 5-(furan-2-yl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide. InChIKey: PQXINDBPUDNMPE-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O3 |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | 5-(furan-2-yl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide |
| InChIKey | PQXINDBPUDNMPE-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NO2)C(=O)NCCCN3C=CN=C3 |
Computed by PubChem (NCBI)