CAS 365542-77-4 appears in our catalog under these names: 6-Despentadecyl, 6-(2-naphthyl)ethyl) Anacardic Acid, SM4/ 98.1% (existing batch purity), Sm4, Sm4 99%, Sm4, 98.10% ,, 98.10% ,. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-hydroxy-6-(2-naphthalen-2-ylethyl)benzoic acid (CAS 365542-77-4) is a chemical compound with the molecular formula C19H16O3 and a molecular weight of 292.3 g/mol. IUPAC name: 2-hydroxy-6-(2-naphthalen-2-ylethyl)benzoic acid. InChIKey: GGVFBUYNEPBFQT-UHFFFAOYSA-N.
| Molecular formula | C19H16O3 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 2-hydroxy-6-(2-naphthalen-2-ylethyl)benzoic acid |
| InChIKey | GGVFBUYNEPBFQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CCC3=C(C(=CC=C3)O)C(=O)O |
Computed by PubChem (NCBI)