CAS 944153-47-3 appears in our catalog under these names: (Z)-1-(4-Chlorophenyl)-3-((3-hydroxyphenyl)amino)but-2-en-1-one, 99%, 99%, SMER18/ 97.27% (existing batch purity), SMER18 99%, SMER18, 98.64%. Offered by: Chemat, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 1mg, 5mg, 10mg, 25mg, 2mg.
(Z)-1-(4-chlorophenyl)-3-(3-hydroxyanilino)but-2-en-1-one (CAS 944153-47-3) is a chemical compound with the molecular formula C16H14ClNO2 and a molecular weight of 287.74 g/mol. IUPAC name: (Z)-1-(4-chlorophenyl)-3-(3-hydroxyanilino)but-2-en-1-one. InChIKey: SNEQASFEVWLKOJ-LUAWRHEFSA-N.
| Molecular formula | C16H14ClNO2 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | (Z)-1-(4-chlorophenyl)-3-(3-hydroxyanilino)but-2-en-1-one |
| InChIKey | SNEQASFEVWLKOJ-LUAWRHEFSA-N |
| SMILES | C/C(=C/C(=O)C1=CC=C(C=C1)Cl)/NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)