Products 331947-69-4

CAS 331947-69-4 is the registry number for Tolvaptan Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.

2-methyl-4-[(2-methylbenzoyl)amino]benzoyl chloride (CAS 331947-69-4) is a chemical compound with the molecular formula C16H14ClNO2 and a molecular weight of 287.74 g/mol. IUPAC name: 2-methyl-4-[(2-methylbenzoyl)amino]benzoyl chloride. InChIKey: UFKZQXMKNNRXQO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14ClNO2
Molecular weight287.74 g/mol
IUPAC name2-methyl-4-[(2-methylbenzoyl)amino]benzoyl chloride
InChIKeyUFKZQXMKNNRXQO-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)Cl)C

Computed by PubChem (NCBI)