CAS 331947-69-4 is the registry number for Tolvaptan Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-[(2-methylbenzoyl)amino]benzoyl chloride (CAS 331947-69-4) is a chemical compound with the molecular formula C16H14ClNO2 and a molecular weight of 287.74 g/mol. IUPAC name: 2-methyl-4-[(2-methylbenzoyl)amino]benzoyl chloride. InChIKey: UFKZQXMKNNRXQO-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO2 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 2-methyl-4-[(2-methylbenzoyl)amino]benzoyl chloride |
| InChIKey | UFKZQXMKNNRXQO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)Cl)C |
Computed by PubChem (NCBI)