CAS 730950-05-7 appears in our catalog under these names: N-(2-Benzoylphenyl)-2-chloropropanamide, 95%, 2-Chloro-N-(2-(phenylcarbonyl)phenyl)propanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
N-(2-benzoylphenyl)-2-chloropropanamide (CAS 730950-05-7) is a chemical compound with the molecular formula C16H14ClNO2 and a molecular weight of 287.74 g/mol. IUPAC name: N-(2-benzoylphenyl)-2-chloropropanamide. InChIKey: SOVFDEUNELESDN-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO2 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | N-(2-benzoylphenyl)-2-chloropropanamide |
| InChIKey | SOVFDEUNELESDN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=CC=C1C(=O)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)