CAS 823218-99-1 appears in our catalog under these names: SN 2/ 99.2% (existing batch purity), SN 2 98%, SN 2, 99.93%, 3-Mesityl-3a,4,5,6,7,7a-hexahydro-4,7-methanobenzo[d]isoxazole, 98%, 98%. Offered by: TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 250mg.
5-(2,4,6-trimethylphenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene (CAS 823218-99-1) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: 5-(2,4,6-trimethylphenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene. InChIKey: WKLZNTYMDOPBSE-UHFFFAOYSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | 5-(2,4,6-trimethylphenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| InChIKey | WKLZNTYMDOPBSE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NOC3C2C4CCC3C4)C |
Computed by PubChem (NCBI)