Products 216450-65-6
CAS 216450-65-6 appears in our catalog under these names: Sophoflavescenol, Sophoflavescenol, ≥98%, ≥98%, Sophoflavescenol, 98.78%, SOPHOFLAVESCENOL, ≥98%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1mg, 10mM (in 1ml dmso), 5mg, 25g, 100g, 5 mg, 1 mg.
3,7-dihydroxy-2-(4-hydroxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)chromen-4-one (CAS 216450-65-6) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: 3,7-dihydroxy-2-(4-hydroxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: VMLJAWUWVVHRNG-UHFFFAOYSA-N.
| Molecular formula | C21H20O6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3,7-dihydroxy-2-(4-hydroxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | VMLJAWUWVVHRNG-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)OC)C(=O)C(=C(O2)C3=CC=C(C=C3)O)O)C |
Computed by PubChem (NCBI)