Products 129178-60-5

CAS 129178-60-5 is the registry number for Spiro[1,3-dioxolane-2,9'-[9h]fluorene]-4,5-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate (CAS 129178-60-5) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: diethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate. InChIKey: UPMROZOSXABACL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H20O6
Molecular weight368.4 g/mol
IUPAC namediethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate
InChIKeyUPMROZOSXABACL-UHFFFAOYSA-N
SMILESCCOC(=O)C1C(OC2(O1)C3=CC=CC=C3C4=CC=CC=C24)C(=O)OCC

Computed by PubChem (NCBI)