Products 199167-23-2

CAS 199167-23-2 appears in our catalog under these names: FBL-03G, >95% (HPLC), Isocannflavin B, 99.90%. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 2,5mg, 500 μg.

Structural formula: {0} (CAS {1})

5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one (CAS 199167-23-2) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: IHRNYHWGJUMPFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H20O6
Molecular weight368.4 g/mol
IUPAC name5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one
InChIKeyIHRNYHWGJUMPFJ-UHFFFAOYSA-N
SMILESCC(=CCC1=C2C(=C(C=C1O)O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)OC)C

Computed by PubChem (NCBI)