Products 76735-58-5
CAS 76735-58-5 appears in our catalog under these names: Cannflavin B, Cannflavin B, >95% (HPLC), Cannflavin B, Canniflavone, 98%, 98%, Cannflavin B, 98.36%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 2mg, 25mg, 10mg, 1 mg.
5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one (CAS 76735-58-5) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one. InChIKey: IXCUTZUASDSIJO-UHFFFAOYSA-N.
| Molecular formula | C21H20O6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | IXCUTZUASDSIJO-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC(=C(C=C3)O)OC)O)C |
Computed by PubChem (NCBI)
Synonyms:
Cannflavin B, 6-prenylchrysoeriol, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one, Canniflavone, Canniflavone 1, Cannaflavin B, orb1941986, 6-Prenyl-5,7,4'-Trihydroxy-3'-methoxyflavone, 5,7-dihydroxy-2-(4-hydroxy-3-methoxy-phenyl)-6-(3-methylbut-2-enyl)chromen-4-one