Products 146670-40-8
CAS 146670-40-8 appears in our catalog under these names: SR 11237, SR11237/ 98.54% (existing batch purity), SR 11237, SR11237, SR11237 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg.
4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid (CAS 146670-40-8) is a chemical compound with the molecular formula C24H28O4 and a molecular weight of 380.5 g/mol. IUPAC name: 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid. InChIKey: ZZUKALQMHNSWTK-UHFFFAOYSA-N.
| Molecular formula | C24H28O4 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid |
| InChIKey | ZZUKALQMHNSWTK-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C3(OCCO3)C4=CC=C(C=C4)C(=O)O)(C)C)C |
Computed by PubChem (NCBI)