Products 87573-01-1
CAS 87573-01-1 appears in our catalog under these names: Salnacedin/ 98.44% (existing batch purity), Salnacedin. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
(2R)-2-acetamido-3-(2-hydroxybenzoyl)sulfanylpropanoic acid (CAS 87573-01-1) is a chemical compound with the molecular formula C12H13NO5S and a molecular weight of 283.30 g/mol. IUPAC name: (2R)-2-acetamido-3-(2-hydroxybenzoyl)sulfanylpropanoic acid. InChIKey: VYPKEODFNOEZGS-VIFPVBQESA-N.
| Molecular formula | C12H13NO5S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(2-hydroxybenzoyl)sulfanylpropanoic acid |
| InChIKey | VYPKEODFNOEZGS-VIFPVBQESA-N |
| SMILES | CC(=O)N[C@@H](CSC(=O)C1=CC=CC=C1O)C(=O)O |
Computed by PubChem (NCBI)