Salsolidine (hydrochloride), 95+%, 95+%
cas: 63283-42-1 — see every product listed under this CAS number, including other names
Salsolidine (hydrochloride), 95+%, 95+% (CAS 63283-42-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N28-1g |
| cas | 63283-42-1 |
| size | 1g |
| availability | 150g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 25g | 1427.60 Pln | |
| Chemat | 10g | 726.80 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 63283-42-1) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: UJXLTDHDLUBZBL-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | UJXLTDHDLUBZBL-UHFFFAOYSA-N |
| SMILES | CC1C2=CC(=C(C=C2CCN1)OC)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, Salsolidine hydrochloride, Salsolidine (hydrochloride), 1,2,3,4-Tetrahydro-6,7-dimethoxy-1-methylisoquinoline hydrochloride, 6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride, Isoquinoline, 6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydro, hydrochloride, Prestwick_860, SalsolidineHCl, Salsolidine HCl, 6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydro-isoquinoline hydrochloride