CAS 1391571-15-5 appears in our catalog under these names: (S)-Methyl 2-amino-3-(2,4-dimethylphenyl)propanoate hydrochloride, 95%, (S)–Methyl 2–amino–3–(2,4–dimethylphenyl)propanoate hydrochloride, (S)-Methyl 2-amino-3-(2,4-dimethylphenyl)propanoate hydrochloride, 95%, 95%, (S)-Methyl 2-amino-3-(2,4-dimethylphenyl)propanoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate;hydrochloride (CAS 1391571-15-5) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate;hydrochloride. InChIKey: CRGIWBPGJAHRNL-MERQFXBCSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate;hydrochloride |
| InChIKey | CRGIWBPGJAHRNL-MERQFXBCSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@@H](C(=O)OC)N)C.Cl |
Computed by PubChem (NCBI)