Products 1208550-10-0
CAS 1208550-10-0 appears in our catalog under these names: (1-(3,4-Dimethoxyphenyl)cyclopropyl)methanamine hydrochloride, 95%, (1-(3,4-Dimethoxyphenyl)cyclopropyl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
[1-(3,4-dimethoxyphenyl)cyclopropyl]methanamine;hydrochloride (CAS 1208550-10-0) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: [1-(3,4-dimethoxyphenyl)cyclopropyl]methanamine;hydrochloride. InChIKey: XMUWTFIFZPHXON-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | [1-(3,4-dimethoxyphenyl)cyclopropyl]methanamine;hydrochloride |
| InChIKey | XMUWTFIFZPHXON-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)CN)OC.Cl |
Computed by PubChem (NCBI)