CAS 1803570-08-2 appears in our catalog under these names: 2-(Methylamino)-2-(2,4,6-trimethylphenyl)acetic acid hydrochloride, 2-(Methylamino)-2-(2,4,6-trimethylphenyl)acetic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 250mg, 1g.
2-(methylamino)-2-(2,4,6-trimethylphenyl)acetic acid;hydrochloride (CAS 1803570-08-2) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 2-(methylamino)-2-(2,4,6-trimethylphenyl)acetic acid;hydrochloride. InChIKey: QIZYGPWBECPFJS-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 2-(methylamino)-2-(2,4,6-trimethylphenyl)acetic acid;hydrochloride |
| InChIKey | QIZYGPWBECPFJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C(=O)O)NC)C.Cl |
Computed by PubChem (NCBI)