Products 1449228-40-3

CAS 1449228-40-3 appears in our catalog under these names: Senexin B/ 99.63% (existing batch purity), Senexin B, Senexin B, >90.0%(HPLC)(qNMR), Senexin B, 98%, 98%, Senexin B, 99.09%. Offered by: TargetMol, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg.

Structural formula: {0} (CAS {1})

4-[2-[6-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl]ethylamino]quinazoline-6-carbonitrile (CAS 1449228-40-3) is a chemical compound with the molecular formula C27H26N6O and a molecular weight of 450.5 g/mol. IUPAC name: 4-[2-[6-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl]ethylamino]quinazoline-6-carbonitrile. InChIKey: VNADJTWHOAMTLY-UHFFFAOYSA-N.

Identity
Molecular formulaC27H26N6O
Molecular weight450.5 g/mol
IUPAC name4-[2-[6-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl]ethylamino]quinazoline-6-carbonitrile
InChIKeyVNADJTWHOAMTLY-UHFFFAOYSA-N
SMILESCN1CCN(CC1)C(=O)C2=CC3=C(C=C2)C=C(C=C3)CCNC4=NC=NC5=C4C=C(C=C5)C#N

Computed by PubChem (NCBI)