Products 1449228-40-3
CAS 1449228-40-3 appears in our catalog under these names: Senexin B/ 99.63% (existing batch purity), Senexin B, Senexin B, >90.0%(HPLC)(qNMR), Senexin B 98%, Senexin B, 98%, 98%. Offered by: TargetMol, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg.
4-[2-[6-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl]ethylamino]quinazoline-6-carbonitrile (CAS 1449228-40-3) is a chemical compound with the molecular formula C27H26N6O and a molecular weight of 450.5 g/mol. IUPAC name: 4-[2-[6-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl]ethylamino]quinazoline-6-carbonitrile. InChIKey: VNADJTWHOAMTLY-UHFFFAOYSA-N.
| Molecular formula | C27H26N6O |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 4-[2-[6-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl]ethylamino]quinazoline-6-carbonitrile |
| InChIKey | VNADJTWHOAMTLY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC3=C(C=C2)C=C(C=C3)CCNC4=NC=NC5=C4C=C(C=C5)C#N |
Computed by PubChem (NCBI)