CAS 441061-33-2 appears in our catalog under these names: Sinbaglustat/ 99.93% (existing batch purity), Sinbaglustat, Sinbaglustat, 99.83%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM/1mL.
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol (CAS 441061-33-2) is a chemical compound with the molecular formula C11H23NO4 and a molecular weight of 233.30 g/mol. IUPAC name: (2S,3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol. InChIKey: HCZQIIVHWYFIPW-UKKRHICBSA-N.
| Molecular formula | C11H23NO4 |
|---|---|
| Molecular weight | 233.30 g/mol |
| IUPAC name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol |
| InChIKey | HCZQIIVHWYFIPW-UKKRHICBSA-N |
| SMILES | CCCCCN1C[C@@H]([C@H]([C@@H]([C@@H]1CO)O)O)O |
Computed by PubChem (NCBI)