cas: 853-68-9 — see every product listed under this CAS number, including other names
Sodium 9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonate 98% (CAS 853-68-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1459930-250mg |
| cas | 853-68-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 676.31 Pln | |
| Ambeed | 10g | 1282.62 Pln | |
| Ambeed | 25g | 1955.69 Pln | |
| Ambeed | 100g | 6355.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1459930 |
Disodium;9,10-dioxoanthracene-2,6-disulfonate (CAS 853-68-9) is a chemical compound with the molecular formula C14H6Na2O8S2 and a molecular weight of 412.3 g/mol. IUPAC name: disodium;9,10-dioxoanthracene-2,6-disulfonate. InChIKey: PKOVWEHDVFYKHL-UHFFFAOYSA-L.
| Molecular formula | C14H6Na2O8S2 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | disodium;9,10-dioxoanthracene-2,6-disulfonate |
| InChIKey | PKOVWEHDVFYKHL-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)[O-])C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)